C22H22N6OS — CID 91818067
3-pyrazol-1-yl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide (PubChem CID 91818067) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 3-pyrazol-1-yl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide.
| Compound Name | 3-pyrazol-1-yl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91818067 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-pyrazol-1-yl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(c2cc(-c3cccs3)[nH]n2)CC1)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C22H22N6OS/c29-22(16-4-1-5-18(14-16)28-10-3-9-23-28)24-17-7-11-27(12-8-17)21-15-19(25-26-21)20-6-2-13-30-20/h1-6,9-10,13-15,17H,7-8,11-12H2,(H,24,29)(H,25,26) |
| InChIKey | DFIHPNTYZNEMIB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |