C19H24N4OS — CID 100744723
(1R)-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 100744723) has the molecular formula C19H24N4OS and a molecular weight of 356.49 g/mol. Its IUPAC name is (1R)-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 100744723 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (1R)-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC1CCN(c2cc(-c3cccs3)[nH]n2)CC1)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C19H24N4OS/c24-19(14-5-2-1-3-6-14)20-15-8-10-23(11-9-15)18-13-16(21-22-18)17-7-4-12-25-17/h1-2,4,7,12-15H,3,5-6,8-11H2,(H,20,24)(H,21,22)/t14-/m0/s1 |
| InChIKey | JMOMXMAQYUEHFG-AWEZNQCLSA-N |
| XLogP | 3.58 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|