C29H29N3O3S — CID 123231274
N-[[2-(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]methyl]-1-benzofuran-4-carboxamide (PubChem CID 123231274) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is N-[[2-(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]methyl]-1-benzofuran-4-carboxamide.
| Compound Name | N-[[2-(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]methyl]-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 123231274 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[[2-(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]methyl]-1-benzofuran-4-carboxamide |
| SMILES | Cc1nc(C(=O)N2CC3CCCCC3C2CNC(=O)c2cccc3occc23)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C29H29N3O3S/c1-18-31-26(27(36-18)19-8-3-2-4-9-19)29(34)32-17-20-10-5-6-11-21(20)24(32)16-30-28(33)23-12-7-13-25-22(23)14-15-35-25/h2-4,7-9,12-15,20-21,24H,5-6,10-11,16-17H2,1H3,(H,30,33) |
| InChIKey | BVNTZGWACXEDPE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |