C20H40N2O2S — CID 123231701
N-(2-tert-butylsulfanylethyl)-3-[octyl(3-oxopropyl)amino]propanamide (PubChem CID 123231701) has the molecular formula C20H40N2O2S and a molecular weight of 372.62 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-3-[octyl(3-oxopropyl)amino]propanamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-3-[octyl(3-oxopropyl)amino]propanamide |
|---|---|
| PubChem CID | 123231701 |
| Molecular Formula | C20H40N2O2S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-3-[octyl(3-oxopropyl)amino]propanamide |
| SMILES | CCCCCCCCN(CCC=O)CCC(=O)NCCSC(C)(C)C |
| InChI | InChI=1S/C20H40N2O2S/c1-5-6-7-8-9-10-14-22(15-11-17-23)16-12-19(24)21-13-18-25-20(2,3)4/h17H,5-16,18H2,1-4H3,(H,21,24) |
| InChIKey | PKEMVRWXQIWOGD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|