C26H21Cl2F4N3O3 — CID 123233227
4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-N-[(E)-2-(propan-2-yloxyamino)ethenyl]naphthalene-1-carboxamide (PubChem CID 123233227) has the molecular formula C26H21Cl2F4N3O3 and a molecular weight of 570.37 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-N-[(E)-2-(propan-2-yloxyamino)ethenyl]naphthalene-1-carboxamide.
| Compound Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-N-[(E)-2-(propan-2-yloxyamino)ethenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 123233227 |
| Molecular Formula | C26H21Cl2F4N3O3 |
| Molecular Weight | 570.37 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-N-[(E)-2-(propan-2-yloxyamino)ethenyl]naphthalene-1-carboxamide |
| SMILES | CC(C)ON/C=C/NC(=O)c1ccc(C2=CC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)ON2)c2ccccc12 |
| InChI | InChI=1S/C26H21Cl2F4N3O3/c1-14(2)37-34-10-9-33-24(36)19-8-7-18(16-5-3-4-6-17(16)19)22-13-25(38-35-22,26(30,31)32)15-11-20(27)23(29)21(28)12-15/h3-14,34-35H,1-2H3,(H,33,36)/b10-9+ |
| InChIKey | TVSJAJXYBYYVRF-MDZDMXLPSA-N |
| XLogP | 6.75 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.37 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|