About 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol
8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol (PubChem CID 123233301) has the molecular formula C9H10FNO2
and a molecular weight of 183.18 g/mol. Its IUPAC name is 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol.
Analyze 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol?
The IUPAC name of 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol (CID 123233301) is 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol.
What is the SMILES notation for 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol?
The canonical SMILES for 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol is Oc1[nH]c(O)c2c1C1CC(F)C2C1.
What is the InChIKey of 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol?
The InChIKey is FRYCBAXNJSTARP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2/c10-5-2-3-1-4(5)7-6(3)8(12)11-9(7)13/h3-5,11-13H,1-2H2.
What are the key properties of 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol?
8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol has a molecular weight of 183.18 g/mol, XLogP of 1.74, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol is sourced from PubChem (CID 123233301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).