About 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one
5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one (PubChem CID 123234429) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one.
Analyze 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one?
The IUPAC name of 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one (CID 123234429) is 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one.
What is the SMILES notation for 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one?
The canonical SMILES for 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one is CC1(C)OCC2C3CC(C3)C(=O)N21.
What is the InChIKey of 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one?
The InChIKey is JTAFXUINGKGWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-10(2)11-8(5-13-10)6-3-7(4-6)9(11)12/h6-8H,3-5H2,1-2H3.
What are the key properties of 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one?
5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one has a molecular weight of 181.23 g/mol, XLogP of 0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-4-oxa-6-azatricyclo[6.1.1.02,6]decan-7-one is sourced from PubChem (CID 123234429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).