C11H17NO3 — CID 10330790
(7S,7aS)-7-[(2R)-but-3-en-2-yl]-3,3-dimethyl-7,7a-dihydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-5-one (PubChem CID 10330790) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is (7S,7aS)-7-[(2R)-but-3-en-2-yl]-3,3-dimethyl-7,7a-dihydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-5-one.
| Compound Name | (7S,7aS)-7-[(2R)-but-3-en-2-yl]-3,3-dimethyl-7,7a-dihydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10330790 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (7S,7aS)-7-[(2R)-but-3-en-2-yl]-3,3-dimethyl-7,7a-dihydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-5-one |
| SMILES | C=C[C@@H](C)[C@@H]1OC(=O)N2[C@H]1COC2(C)C |
| InChI | InChI=1S/C11H17NO3/c1-5-7(2)9-8-6-14-11(3,4)12(8)10(13)15-9/h5,7-9H,1,6H2,2-4H3/t7-,8+,9+/m1/s1 |
| InChIKey | YFNMBYBVTZCFSO-VGMNWLOBSA-N |
| XLogP | 1.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|