C11H19NO — CID 139386201
(7R,7aS)-7-ethyl-3,3-dimethyl-5-methylidene-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole (PubChem CID 139386201) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (7R,7aS)-7-ethyl-3,3-dimethyl-5-methylidene-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (7R,7aS)-7-ethyl-3,3-dimethyl-5-methylidene-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 139386201 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (7R,7aS)-7-ethyl-3,3-dimethyl-5-methylidene-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole |
| SMILES | C=C1C[C@@H](CC)[C@H]2COC(C)(C)N12 |
| InChI | InChI=1S/C11H19NO/c1-5-9-6-8(2)12-10(9)7-13-11(12,3)4/h9-10H,2,5-7H2,1,3-4H3/t9-,10-/m1/s1 |
| InChIKey | CMVKNQKUHQYEIQ-NXEZZACHSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |