C15H19NO4S — CID 166733993
methyl 4-[(7aS)-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]benzenesulfinate (PubChem CID 166733993) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 4-[(7aS)-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]benzenesulfinate.
| Compound Name | methyl 4-[(7aS)-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]benzenesulfinate |
|---|---|
| PubChem CID | 166733993 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 4-[(7aS)-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]benzenesulfinate |
| SMILES | COS(=O)c1ccc(C2CC(=O)N3[C@@H]2COC3(C)C)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-15(2)16-13(9-20-15)12(8-14(16)17)10-4-6-11(7-5-10)21(18)19-3/h4-7,12-13H,8-9H2,1-3H3/t12?,13-,21?/m1/s1 |
| InChIKey | GOBQXKAYLIOLKI-BXWNDJAQSA-N |
| XLogP | 1.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |