C9H15Cl2NO2 — CID 70676873
2,2-dichloro-1-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone (PubChem CID 70676873) has the molecular formula C9H15Cl2NO2 and a molecular weight of 240.13 g/mol. Its IUPAC name is 2,2-dichloro-1-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 70676873 |
| Molecular Formula | C9H15Cl2NO2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2,2-dichloro-1-[(4R)-4-ethyl-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
| SMILES | CC[C@@H]1COC(C)(C)N1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C9H15Cl2NO2/c1-4-6-5-14-9(2,3)12(6)8(13)7(10)11/h6-7H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | HECCNTMYLXTXFZ-ZCFIWIBFSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|