C16H27N — CID 123236878
5-tert-butyl-N-ethyl-3,4-dimethylocta-2,4,6-trien-1-imine (PubChem CID 123236878) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 5-tert-butyl-N-ethyl-3,4-dimethylocta-2,4,6-trien-1-imine.
| Compound Name | 5-tert-butyl-N-ethyl-3,4-dimethylocta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 123236878 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 5-tert-butyl-N-ethyl-3,4-dimethylocta-2,4,6-trien-1-imine |
| SMILES | CC=CC(=C(C)C(C)=C/C=N/CC)C(C)(C)C |
| InChI | InChI=1S/C16H27N/c1-8-10-15(16(5,6)7)14(4)13(3)11-12-17-9-2/h8,10-12H,9H2,1-7H3/b10-8?,13-11?,15-14?,17-12+ |
| InChIKey | NSAFVKHWILQZIR-AFVCQQLZSA-N |
| XLogP | 4.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|