C26H40FN — CID 176556879
(2Z,6E)-2,7-ditert-butyl-N-[(2E,3E)-2-ethylidene-4-fluoro-3-methylhexa-3,5-dienyl]nona-2,6,8-trien-1-imine (PubChem CID 176556879) has the molecular formula C26H40FN and a molecular weight of 385.61 g/mol. Its IUPAC name is (2Z,6E)-2,7-ditert-butyl-N-[(2E,3E)-2-ethylidene-4-fluoro-3-methylhexa-3,5-dienyl]nona-2,6,8-trien-1-imine.
| Compound Name | (2Z,6E)-2,7-ditert-butyl-N-[(2E,3E)-2-ethylidene-4-fluoro-3-methylhexa-3,5-dienyl]nona-2,6,8-trien-1-imine |
|---|---|
| PubChem CID | 176556879 |
| Molecular Formula | C26H40FN |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | (2Z,6E)-2,7-ditert-butyl-N-[(2E,3E)-2-ethylidene-4-fluoro-3-methylhexa-3,5-dienyl]nona-2,6,8-trien-1-imine |
| SMILES | C=C/C(=C\CC/C=C(\C=N\CC(=C/C)/C(C)=C(/F)C=C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H40FN/c1-11-21(20(4)24(27)13-3)18-28-19-23(26(8,9)10)17-15-14-16-22(12-2)25(5,6)7/h11-13,16-17,19H,2-3,14-15,18H2,1,4-10H3/b21-11-,22-16+,23-17+,24-20+,28-19+ |
| InChIKey | JMIZDPFTFHNEHF-KQKNSZFKSA-N |
| XLogP | 8.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|