C19H37N — CID 142143344
ethane;(E,2E,3Z)-3-ethylidene-N-methyl-2-prop-2-enylidenehept-4-en-1-imine (PubChem CID 142143344) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is ethane;(E,2E,3Z)-3-ethylidene-N-methyl-2-prop-2-enylidenehept-4-en-1-imine.
| Compound Name | ethane;(E,2E,3Z)-3-ethylidene-N-methyl-2-prop-2-enylidenehept-4-en-1-imine |
|---|---|
| PubChem CID | 142143344 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | ethane;(E,2E,3Z)-3-ethylidene-N-methyl-2-prop-2-enylidenehept-4-en-1-imine |
| SMILES | C=C/C=C(/C=N/C)C(=C/C)\C=C\CC.CC.CC.CC |
| InChI | InChI=1S/C13H19N.3C2H6/c1-5-8-10-12(7-3)13(9-6-2)11-14-4;3*1-2/h6-11H,2,5H2,1,3-4H3;3*1-2H3/b10-8+,12-7-,13-9-,14-11+;;; |
| InChIKey | SZJWPWGIPGOWBS-HXOUDOTLSA-N |
| XLogP | 6.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|