C20H33N — CID 142219473
ethane;(2E)-2-[(Z)-prop-1-enyl]-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]penta-2,4-dien-1-imine (PubChem CID 142219473) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is ethane;(2E)-2-[(Z)-prop-1-enyl]-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]penta-2,4-dien-1-imine.
| Compound Name | ethane;(2E)-2-[(Z)-prop-1-enyl]-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142219473 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | ethane;(2E)-2-[(Z)-prop-1-enyl]-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]penta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=C/C)/C=N/CC(/C=C\C)=C/C=C.CC.CC |
| InChI | InChI=1S/C16H21N.2C2H6/c1-5-9-15(10-6-2)13-17-14-16(11-7-3)12-8-4;2*1-2/h5-13H,1,3,14H2,2,4H3;2*1-2H3/b10-6-,12-8-,15-9+,16-11+,17-13+;; |
| InChIKey | OUOAKDVBBMVFDK-DSMMCGARSA-N |
| XLogP | 6.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|