C18H18N2Y2-2 — CID 58604558
1-(4-methylbenzene-6-id-1-yl)-N-[2-[(2-methylbenzene-6-id-1-yl)methylideneamino]ethyl]methanimine;bis(yttrium) (PubChem CID 58604558) has the molecular formula C18H18N2Y2-2 and a molecular weight of 440.17 g/mol. Its IUPAC name is 1-(4-methylbenzene-6-id-1-yl)-N-[2-[(2-methylbenzene-6-id-1-yl)methylideneamino]ethyl]methanimine;bis(yttrium).
| Compound Name | 1-(4-methylbenzene-6-id-1-yl)-N-[2-[(2-methylbenzene-6-id-1-yl)methylideneamino]ethyl]methanimine;bis(yttrium) |
|---|---|
| PubChem CID | 58604558 |
| Molecular Formula | C18H18N2Y2-2 |
| Molecular Weight | 440.17 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | 1-(4-methylbenzene-6-id-1-yl)-N-[2-[(2-methylbenzene-6-id-1-yl)methylideneamino]ethyl]methanimine;bis(yttrium) |
| SMILES | Cc1c[c-]c(/C=N/CC/N=C/c2[c-]cccc2C)cc1.[Y].[Y] |
| InChI | InChI=1S/C18H18N2.2Y/c1-15-7-9-17(10-8-15)13-19-11-12-20-14-18-6-4-3-5-16(18)2;;/h3-5,7-9,13-14H,11-12H2,1-2H3;;/q-2;;/b19-13+,20-14+;; |
| InChIKey | GFEXKUNLRFKUKN-HPKCLRQXSA-N |
| XLogP | 3.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.17 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|