C19H27N — CID 72660199
N-butyl-2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaen-1-imine (PubChem CID 72660199) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is N-butyl-2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaen-1-imine.
| Compound Name | N-butyl-2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaen-1-imine |
|---|---|
| PubChem CID | 72660199 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-butyl-2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaen-1-imine |
| SMILES | C=CC(=C)C=CC=C(C)C=CC=C(C)/C=N/CCCC |
| InChI | InChI=1S/C19H27N/c1-6-8-15-20-16-19(5)14-10-13-18(4)12-9-11-17(3)7-2/h7,9-14,16H,2-3,6,8,15H2,1,4-5H3/b11-9?,13-10?,18-12?,19-14?,20-16+ |
| InChIKey | FRJVVMYEQJVBBV-GXWFRUBCSA-N |
| XLogP | 5.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|