C9H10FN — CID 143995117
1-(5-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanimine (PubChem CID 143995117) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is 1-(5-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanimine.
| Compound Name | 1-(5-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanimine |
|---|---|
| PubChem CID | 143995117 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 1-(5-fluorocyclohepta-1,3,6-trien-1-yl)-N-methylmethanimine |
| SMILES | C/N=C/C1=CC=CC(F)C=C1 |
| InChI | InChI=1S/C9H10FN/c1-11-7-8-3-2-4-9(10)6-5-8/h2-7,9H,1H3/b11-7+ |
| InChIKey | IZNMCTWMZLZVML-YRNVUSSQSA-N |
| XLogP | 2.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|