C11H13ClFN — CID 134343094
(E)-N-[(2E)-2-chloropenta-2,4-dienyl]-3-fluoro-2-methylidenepent-3-en-1-imine (PubChem CID 134343094) has the molecular formula C11H13ClFN and a molecular weight of 213.68 g/mol. Its IUPAC name is (E)-N-[(2E)-2-chloropenta-2,4-dienyl]-3-fluoro-2-methylidenepent-3-en-1-imine.
| Compound Name | (E)-N-[(2E)-2-chloropenta-2,4-dienyl]-3-fluoro-2-methylidenepent-3-en-1-imine |
|---|---|
| PubChem CID | 134343094 |
| Molecular Formula | C11H13ClFN |
| Molecular Weight | 213.68 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | (E)-N-[(2E)-2-chloropenta-2,4-dienyl]-3-fluoro-2-methylidenepent-3-en-1-imine |
| SMILES | C=C/C=C(/Cl)C/N=C/C(=C)/C(F)=C\C |
| InChI | InChI=1S/C11H13ClFN/c1-4-6-10(12)8-14-7-9(3)11(13)5-2/h4-7H,1,3,8H2,2H3/b10-6+,11-5+,14-7+ |
| InChIKey | ZKNFQVYYVSFUFD-RBOGMJBBSA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|