C9H11F2N — CID 155306408
(3E,5E)-3,5-difluoro-N-methyl-2-methylidenehepta-3,5-dien-1-imine (PubChem CID 155306408) has the molecular formula C9H11F2N and a molecular weight of 171.19 g/mol. Its IUPAC name is (3E,5E)-3,5-difluoro-N-methyl-2-methylidenehepta-3,5-dien-1-imine.
| Compound Name | (3E,5E)-3,5-difluoro-N-methyl-2-methylidenehepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 155306408 |
| Molecular Formula | C9H11F2N |
| Molecular Weight | 171.19 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (3E,5E)-3,5-difluoro-N-methyl-2-methylidenehepta-3,5-dien-1-imine |
| SMILES | C=C(/C=N/C)/C(F)=C\C(F)=C/C |
| InChI | InChI=1S/C9H11F2N/c1-4-8(10)5-9(11)7(2)6-12-3/h4-6H,2H2,1,3H3/b8-4+,9-5+,12-6+ |
| InChIKey | OBOGEFICRNVPDD-SRWLDKPRSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|