C11H14F3NS — CID 123528785
2-[[(E)-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]pent-2-enylidene]amino]ethanethial (PubChem CID 123528785) has the molecular formula C11H14F3NS and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-[[(E)-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]pent-2-enylidene]amino]ethanethial.
| Compound Name | 2-[[(E)-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]pent-2-enylidene]amino]ethanethial |
|---|---|
| PubChem CID | 123528785 |
| Molecular Formula | C11H14F3NS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-[[(E)-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]pent-2-enylidene]amino]ethanethial |
| SMILES | CC/C=C(/C=N/CC=S)\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NS/c1-3-4-10(8-15-5-6-16)7-9(2)11(12,13)14/h4,6-8H,3,5H2,1-2H3/b9-7+,10-4+,15-8+ |
| InChIKey | AZIDDQFVFABIQH-BTOIDKRISA-N |
| XLogP | 3.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|