C9H12F3N — CID 134466502
(E)-4,4,4-trifluoro-N,3-dimethyl-2-prop-1-en-2-ylbut-2-en-1-imine (PubChem CID 134466502) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-N,3-dimethyl-2-prop-1-en-2-ylbut-2-en-1-imine.
| Compound Name | (E)-4,4,4-trifluoro-N,3-dimethyl-2-prop-1-en-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 134466502 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (E)-4,4,4-trifluoro-N,3-dimethyl-2-prop-1-en-2-ylbut-2-en-1-imine |
| SMILES | C=C(C)C(/C=N/C)=C(/C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-6(2)8(5-13-4)7(3)9(10,11)12/h5H,1H2,2-4H3/b8-7-,13-5+ |
| InChIKey | NOHKMGYKCPDKLV-XYGSGGKESA-N |
| XLogP | 3.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|