C10H15F2N — CID 134466495
(E)-4,4-difluoro-N,3-dimethyl-2-prop-1-en-2-ylpent-2-en-1-imine (PubChem CID 134466495) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is (E)-4,4-difluoro-N,3-dimethyl-2-prop-1-en-2-ylpent-2-en-1-imine.
| Compound Name | (E)-4,4-difluoro-N,3-dimethyl-2-prop-1-en-2-ylpent-2-en-1-imine |
|---|---|
| PubChem CID | 134466495 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (E)-4,4-difluoro-N,3-dimethyl-2-prop-1-en-2-ylpent-2-en-1-imine |
| SMILES | C=C(C)C(/C=N/C)=C(/C)C(C)(F)F |
| InChI | InChI=1S/C10H15F2N/c1-7(2)9(6-13-5)8(3)10(4,11)12/h6H,1H2,2-5H3/b9-8-,13-6+ |
| InChIKey | HHLLCUBRVNCHQY-GFBXJKNCSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|