C9H13F2NS — CID 142910752
(4E)-3,3-difluoro-4-(methyliminomethyl)hepta-4,6-diene-1-thiol (PubChem CID 142910752) has the molecular formula C9H13F2NS and a molecular weight of 205.27 g/mol. Its IUPAC name is (4E)-3,3-difluoro-4-(methyliminomethyl)hepta-4,6-diene-1-thiol.
| Compound Name | (4E)-3,3-difluoro-4-(methyliminomethyl)hepta-4,6-diene-1-thiol |
|---|---|
| PubChem CID | 142910752 |
| Molecular Formula | C9H13F2NS |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (4E)-3,3-difluoro-4-(methyliminomethyl)hepta-4,6-diene-1-thiol |
| SMILES | C=C/C=C(\C=N\C)C(F)(F)CCS |
| InChI | InChI=1S/C9H13F2NS/c1-3-4-8(7-12-2)9(10,11)5-6-13/h3-4,7,13H,1,5-6H2,2H3/b8-4+,12-7+ |
| InChIKey | IMHIYNSJOAJRSW-YLCPTLHCSA-N |
| XLogP | 2.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|