C19H37N — CID 142605616
(3Z)-N-butyl-2,6-dimethyl-2-propan-2-ylhepta-3,5-dien-1-imine;propane (PubChem CID 142605616) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is (3Z)-N-butyl-2,6-dimethyl-2-propan-2-ylhepta-3,5-dien-1-imine;propane.
| Compound Name | (3Z)-N-butyl-2,6-dimethyl-2-propan-2-ylhepta-3,5-dien-1-imine;propane |
|---|---|
| PubChem CID | 142605616 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | (3Z)-N-butyl-2,6-dimethyl-2-propan-2-ylhepta-3,5-dien-1-imine;propane |
| SMILES | CCC.CCCC/N=C/C(C)(/C=C\C=C(C)C)C(C)C |
| InChI | InChI=1S/C16H29N.C3H8/c1-7-8-12-17-13-16(6,15(4)5)11-9-10-14(2)3;1-3-2/h9-11,13,15H,7-8,12H2,1-6H3;3H2,1-2H3/b11-9-,17-13+; |
| InChIKey | XISFDOZXSXKRAR-ZKMKMSTMSA-N |
| XLogP | 6.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|