C11H17N — CID 123261193
3,6-dimethyl-3-propan-2-ylazepine (PubChem CID 123261193) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 3,6-dimethyl-3-propan-2-ylazepine.
| Compound Name | 3,6-dimethyl-3-propan-2-ylazepine |
|---|---|
| PubChem CID | 123261193 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 3,6-dimethyl-3-propan-2-ylazepine |
| SMILES | CC1=CN=CC(C)(C(C)C)C=C1 |
| InChI | InChI=1S/C11H17N/c1-9(2)11(4)6-5-10(3)7-12-8-11/h5-9H,1-4H3 |
| InChIKey | AZNVQQJNOLJKEL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |