C23H37N — CID 155724050
ethane;(2Z,4E,6Z)-2-ethyl-N,8-dimethyl-4-[(E)-2-methylbut-2-enylidene]-5-propan-2-ylidenenona-2,6,8-trien-1-imine (PubChem CID 155724050) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is ethane;(2Z,4E,6Z)-2-ethyl-N,8-dimethyl-4-[(E)-2-methylbut-2-enylidene]-5-propan-2-ylidenenona-2,6,8-trien-1-imine.
| Compound Name | ethane;(2Z,4E,6Z)-2-ethyl-N,8-dimethyl-4-[(E)-2-methylbut-2-enylidene]-5-propan-2-ylidenenona-2,6,8-trien-1-imine |
|---|---|
| PubChem CID | 155724050 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | ethane;(2Z,4E,6Z)-2-ethyl-N,8-dimethyl-4-[(E)-2-methylbut-2-enylidene]-5-propan-2-ylidenenona-2,6,8-trien-1-imine |
| SMILES | C=C(C)/C=C/C(=C(C)C)C(/C=C(/C=N\C)CC)=C/C(C)=C/C.CC |
| InChI | InChI=1S/C21H31N.C2H6/c1-9-18(7)13-20(14-19(10-2)15-22-8)21(17(5)6)12-11-16(3)4;1-2/h9,11-15H,3,10H2,1-2,4-8H3;1-2H3/b12-11-,18-9+,19-14-,20-13+,22-15-; |
| InChIKey | VIYGHLVHCYNLNF-QDFOUZKZSA-N |
| XLogP | 7.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|