C23H28N2O — CID 123237148
N-[1-[4-[(E)-1-benzyliminopent-2-en-3-yl]phenyl]propyl]acetamide (PubChem CID 123237148) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[1-[4-[(E)-1-benzyliminopent-2-en-3-yl]phenyl]propyl]acetamide.
| Compound Name | N-[1-[4-[(E)-1-benzyliminopent-2-en-3-yl]phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 123237148 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[1-[4-[(E)-1-benzyliminopent-2-en-3-yl]phenyl]propyl]acetamide |
| SMILES | CC/C(=C\C=N\Cc1ccccc1)c1ccc(C(CC)NC(C)=O)cc1 |
| InChI | InChI=1S/C23H28N2O/c1-4-20(15-16-24-17-19-9-7-6-8-10-19)21-11-13-22(14-12-21)23(5-2)25-18(3)26/h6-16,23H,4-5,17H2,1-3H3,(H,25,26)/b20-15+,24-16+ |
| InChIKey | LXTYASWOWYQKKB-XTONLTPISA-N |
| XLogP | 5.34 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|