C26H21F3N2O3 — CID 123238274
N-hydroxy-2-[3-phenyl-2-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 123238274) has the molecular formula C26H21F3N2O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-hydroxy-2-[3-phenyl-2-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | N-hydroxy-2-[3-phenyl-2-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 123238274 |
| Molecular Formula | C26H21F3N2O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-hydroxy-2-[3-phenyl-2-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CN(C(=O)C(=Cc1ccccc1)c1ccc(C(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C26H21F3N2O3/c27-26(28,29)22-10-8-19(9-11-22)23(14-17-4-2-1-3-5-17)25(33)31-13-12-18-6-7-20(24(32)30-34)15-21(18)16-31/h1-11,14-15,34H,12-13,16H2,(H,30,32) |
| InChIKey | FJJULFMRYNIZSL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|