C25H20FN3O5 — CID 88923110
2-[(Z)-2-(4-fluorophenyl)-3-(3-nitrophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 88923110) has the molecular formula C25H20FN3O5 and a molecular weight of 461.45 g/mol. Its IUPAC name is 2-[(Z)-2-(4-fluorophenyl)-3-(3-nitrophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | 2-[(Z)-2-(4-fluorophenyl)-3-(3-nitrophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 88923110 |
| Molecular Formula | C25H20FN3O5 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-[(Z)-2-(4-fluorophenyl)-3-(3-nitrophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CN(C(=O)/C(=C\c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C25H20FN3O5/c26-21-8-6-18(7-9-21)23(13-16-2-1-3-22(12-16)29(33)34)25(31)28-11-10-17-4-5-19(24(30)27-32)14-20(17)15-28/h1-9,12-14,32H,10-11,15H2,(H,27,30)/b23-13- |
| InChIKey | DBNMICRZQDYNFV-QRVIBDJDSA-N |
| XLogP | 3.98 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|