C24H18ClFN2O3 — CID 88922913
1-[(E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-2,3-dihydroindole-5-carboxamide (PubChem CID 88922913) has the molecular formula C24H18ClFN2O3 and a molecular weight of 436.87 g/mol. Its IUPAC name is 1-[(E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-[(E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 88922913 |
| Molecular Formula | C24H18ClFN2O3 |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-[(E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-2,3-dihydroindole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CCN2C(=O)/C(=C/c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H18ClFN2O3/c25-19-6-1-15(2-7-19)13-21(16-3-8-20(26)9-4-16)24(30)28-12-11-17-14-18(23(29)27-31)5-10-22(17)28/h1-10,13-14,31H,11-12H2,(H,27,29)/b21-13+ |
| InChIKey | FADIAWXQWHLVFN-FYJGNVAPSA-N |
| XLogP | 4.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|