C24H21FN2O3S — CID 72680323
5-[3-(3-fluorophenyl)-2-(4-methylphenyl)prop-2-enoyl]-N-hydroxy-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide (PubChem CID 72680323) has the molecular formula C24H21FN2O3S and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-[3-(3-fluorophenyl)-2-(4-methylphenyl)prop-2-enoyl]-N-hydroxy-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide.
| Compound Name | 5-[3-(3-fluorophenyl)-2-(4-methylphenyl)prop-2-enoyl]-N-hydroxy-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 72680323 |
| Molecular Formula | C24H21FN2O3S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 5-[3-(3-fluorophenyl)-2-(4-methylphenyl)prop-2-enoyl]-N-hydroxy-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide |
| SMILES | Cc1ccc(C(=Cc2cccc(F)c2)C(=O)N2CCc3sc(C(=O)NO)cc3C2)cc1 |
| InChI | InChI=1S/C24H21FN2O3S/c1-15-5-7-17(8-6-15)20(12-16-3-2-4-19(25)11-16)24(29)27-10-9-21-18(14-27)13-22(31-21)23(28)26-30/h2-8,11-13,30H,9-10,14H2,1H3,(H,26,28) |
| InChIKey | FMKKHSNGGMCGRY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|