C16H17N3O3S — CID 90733683
2-N-hydroxy-6-N-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxamide (PubChem CID 90733683) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-N-hydroxy-6-N-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-hydroxy-6-N-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 90733683 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-N-hydroxy-6-N-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCc3cc(C(=O)NO)sc3C2)cc1 |
| InChI | InChI=1S/C16H17N3O3S/c1-10-2-4-12(5-3-10)17-16(21)19-7-6-11-8-13(15(20)18-22)23-14(11)9-19/h2-5,8,22H,6-7,9H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | PBDFNFOZJAIKTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|