C19H17N3O3S2 — CID 58157604
2-N-hydroxy-6-N-(5-phenylthiophen-2-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxamide (PubChem CID 58157604) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-N-hydroxy-6-N-(5-phenylthiophen-2-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-hydroxy-6-N-(5-phenylthiophen-2-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 58157604 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-N-hydroxy-6-N-(5-phenylthiophen-2-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxamide |
| SMILES | O=C(NO)c1cc2c(s1)CN(C(=O)Nc1ccc(-c3ccccc3)s1)CC2 |
| InChI | InChI=1S/C19H17N3O3S2/c23-18(21-25)15-10-13-8-9-22(11-16(13)26-15)19(24)20-17-7-6-14(27-17)12-4-2-1-3-5-12/h1-7,10,25H,8-9,11H2,(H,20,24)(H,21,23) |
| InChIKey | NJMBJZZOOGHSLQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|