C22H22N2O2S — CID 58924495
5-(2-benzyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)-N-hydroxythiophene-2-carboxamide (PubChem CID 58924495) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 5-(2-benzyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)-N-hydroxythiophene-2-carboxamide.
| Compound Name | 5-(2-benzyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)-N-hydroxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 58924495 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 5-(2-benzyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)-N-hydroxythiophene-2-carboxamide |
| SMILES | O=C(NO)c1ccc(-c2ccc3c(c2)CN(Cc2ccccc2)CCC3)s1 |
| InChI | InChI=1S/C22H22N2O2S/c25-22(23-26)21-11-10-20(27-21)18-9-8-17-7-4-12-24(15-19(17)13-18)14-16-5-2-1-3-6-16/h1-3,5-6,8-11,13,26H,4,7,12,14-15H2,(H,23,25) |
| InChIKey | MRMCVDIDWITKOF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|