C5H10N4 — CID 123239006
5-ethylpyrazole-1,3-diamine (PubChem CID 123239006) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is 5-ethylpyrazole-1,3-diamine.
| Compound Name | 5-ethylpyrazole-1,3-diamine |
|---|---|
| PubChem CID | 123239006 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 5-ethylpyrazole-1,3-diamine |
| SMILES | CCc1cc(N)nn1N |
| InChI | InChI=1S/C5H10N4/c1-2-4-3-5(6)8-9(4)7/h3H,2,7H2,1H3,(H2,6,8) |
| InChIKey | CBOXHQKGBHAKKG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |