C12H12F3N3 — CID 81253459
5-ethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-3-amine (PubChem CID 81253459) has the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 5-ethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-3-amine.
| Compound Name | 5-ethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 81253459 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-ethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-3-amine |
| SMILES | CCc1cc(N)nn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3N3/c1-2-9-7-11(16)17-18(9)10-5-3-8(4-6-10)12(13,14)15/h3-7H,2H2,1H3,(H2,16,17) |
| InChIKey | WUDVDZTVUCCAFW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |