C26H47NO — CID 123239648
4-[3,5-dimethyl-5-(5-methyloct-5-en-2-yl)-6-(2-methylpropylidene)oxepan-2-yl]piperidine (PubChem CID 123239648) has the molecular formula C26H47NO and a molecular weight of 389.67 g/mol. Its IUPAC name is 4-[3,5-dimethyl-5-(5-methyloct-5-en-2-yl)-6-(2-methylpropylidene)oxepan-2-yl]piperidine.
| Compound Name | 4-[3,5-dimethyl-5-(5-methyloct-5-en-2-yl)-6-(2-methylpropylidene)oxepan-2-yl]piperidine |
|---|---|
| PubChem CID | 123239648 |
| Molecular Formula | C26H47NO |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.37 |
| IUPAC Name | 4-[3,5-dimethyl-5-(5-methyloct-5-en-2-yl)-6-(2-methylpropylidene)oxepan-2-yl]piperidine |
| SMILES | CCC=C(C)CCC(C)C1(C)CC(C)C(C2CCNCC2)OCC1=CC(C)C |
| InChI | InChI=1S/C26H47NO/c1-8-9-20(4)10-11-22(6)26(7)17-21(5)25(23-12-14-27-15-13-23)28-18-24(26)16-19(2)3/h9,16,19,21-23,25,27H,8,10-15,17-18H2,1-7H3 |
| InChIKey | ADENZKQALLCTMI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|