C25H50N2O — CID 163970162
(Z,3S)-N-methyl-3-[(6S)-6-methyloctan-4-yl]oxy-7-[(3S,4S)-3-methylpiperidin-4-yl]non-7-en-1-amine (PubChem CID 163970162) has the molecular formula C25H50N2O and a molecular weight of 394.69 g/mol. Its IUPAC name is (Z,3S)-N-methyl-3-[(6S)-6-methyloctan-4-yl]oxy-7-[(3S,4S)-3-methylpiperidin-4-yl]non-7-en-1-amine.
| Compound Name | (Z,3S)-N-methyl-3-[(6S)-6-methyloctan-4-yl]oxy-7-[(3S,4S)-3-methylpiperidin-4-yl]non-7-en-1-amine |
|---|---|
| PubChem CID | 163970162 |
| Molecular Formula | C25H50N2O |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.39 |
| IUPAC Name | (Z,3S)-N-methyl-3-[(6S)-6-methyloctan-4-yl]oxy-7-[(3S,4S)-3-methylpiperidin-4-yl]non-7-en-1-amine |
| SMILES | C/C=C(/CCC[C@@H](CCNC)OC(CCC)C[C@@H](C)CC)[C@H]1CCNC[C@H]1C |
| InChI | InChI=1S/C25H50N2O/c1-7-11-24(18-20(4)8-2)28-23(14-16-26-6)13-10-12-22(9-3)25-15-17-27-19-21(25)5/h9,20-21,23-27H,7-8,10-19H2,1-6H3/b22-9-/t20-,21+,23-,24?,25-/m0/s1 |
| InChIKey | SPHZQQHZVLQDHI-ZCUYZDGTSA-N |
| XLogP | 5.95 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|