C17H34N2O — CID 71182686
3-[4-(2-aminoethyl)-4,5-dimethylcyclohexen-1-yl]-5-methoxy-N-methylpentan-1-amine (PubChem CID 71182686) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)-4,5-dimethylcyclohexen-1-yl]-5-methoxy-N-methylpentan-1-amine.
| Compound Name | 3-[4-(2-aminoethyl)-4,5-dimethylcyclohexen-1-yl]-5-methoxy-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 71182686 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 3-[4-(2-aminoethyl)-4,5-dimethylcyclohexen-1-yl]-5-methoxy-N-methylpentan-1-amine |
| SMILES | CNCCC(CCOC)C1=CCC(C)(CCN)C(C)C1 |
| InChI | InChI=1S/C17H34N2O/c1-14-13-16(5-8-17(14,2)9-10-18)15(6-11-19-3)7-12-20-4/h5,14-15,19H,6-13,18H2,1-4H3 |
| InChIKey | QBIWSSVEVZXMKN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|