C17H33NO — CID 144988971
4-[(3S)-3-methyl-4-(2,3,3-trimethylbutan-2-yloxy)butyl]-1,2,3,6-tetrahydropyridine (PubChem CID 144988971) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 4-[(3S)-3-methyl-4-(2,3,3-trimethylbutan-2-yloxy)butyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(3S)-3-methyl-4-(2,3,3-trimethylbutan-2-yloxy)butyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 144988971 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 4-[(3S)-3-methyl-4-(2,3,3-trimethylbutan-2-yloxy)butyl]-1,2,3,6-tetrahydropyridine |
| SMILES | C[C@@H](CCC1=CCNCC1)COC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33NO/c1-14(7-8-15-9-11-18-12-10-15)13-19-17(5,6)16(2,3)4/h9,14,18H,7-8,10-13H2,1-6H3/t14-/m0/s1 |
| InChIKey | LLUQGSJMTYMCQO-AWEZNQCLSA-N |
| XLogP | 4.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|