C22H37NO — CID 146248083
(E)-N-[2-[(4R)-2-ethyl-2-methyl-4-[(3E)-penta-1,3-dien-3-yl]oxan-4-yl]ethyl]-2-prop-1-en-2-ylbut-2-en-1-amine (PubChem CID 146248083) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is (E)-N-[2-[(4R)-2-ethyl-2-methyl-4-[(3E)-penta-1,3-dien-3-yl]oxan-4-yl]ethyl]-2-prop-1-en-2-ylbut-2-en-1-amine.
| Compound Name | (E)-N-[2-[(4R)-2-ethyl-2-methyl-4-[(3E)-penta-1,3-dien-3-yl]oxan-4-yl]ethyl]-2-prop-1-en-2-ylbut-2-en-1-amine |
|---|---|
| PubChem CID | 146248083 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | (E)-N-[2-[(4R)-2-ethyl-2-methyl-4-[(3E)-penta-1,3-dien-3-yl]oxan-4-yl]ethyl]-2-prop-1-en-2-ylbut-2-en-1-amine |
| SMILES | C=C/C(=C\C)[C@]1(CCNC/C(=C/C)C(=C)C)CCOC(C)(CC)C1 |
| InChI | InChI=1S/C22H37NO/c1-8-19(18(5)6)16-23-14-12-22(20(9-2)10-3)13-15-24-21(7,11-4)17-22/h8-10,23H,2,5,11-17H2,1,3-4,6-7H3/b19-8-,20-10+/t21?,22-/m1/s1 |
| InChIKey | BGJOOWFLWNYCFR-ATOXZQMXSA-N |
| XLogP | 5.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|