C25H41NO — CID 166686017
(2E)-2-ethylidene-N-[2-[(4R)-2-ethyl-2-methyl-4-[(3E)-5-methylhexa-1,3,5-trien-3-yl]oxan-4-yl]ethyl]-4-methylpent-3-en-1-amine (PubChem CID 166686017) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is (2E)-2-ethylidene-N-[2-[(4R)-2-ethyl-2-methyl-4-[(3E)-5-methylhexa-1,3,5-trien-3-yl]oxan-4-yl]ethyl]-4-methylpent-3-en-1-amine.
| Compound Name | (2E)-2-ethylidene-N-[2-[(4R)-2-ethyl-2-methyl-4-[(3E)-5-methylhexa-1,3,5-trien-3-yl]oxan-4-yl]ethyl]-4-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 166686017 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | (2E)-2-ethylidene-N-[2-[(4R)-2-ethyl-2-methyl-4-[(3E)-5-methylhexa-1,3,5-trien-3-yl]oxan-4-yl]ethyl]-4-methylpent-3-en-1-amine |
| SMILES | C=C/C(=C\C(=C)C)[C@]1(CCNC/C(C=C(C)C)=C/C)CCOC(C)(CC)C1 |
| InChI | InChI=1S/C25H41NO/c1-9-22(16-20(4)5)18-26-14-12-25(23(10-2)17-21(6)7)13-15-27-24(8,11-3)19-25/h9-10,16-17,26H,2,6,11-15,18-19H2,1,3-5,7-8H3/b22-9+,23-17+/t24?,25-/m1/s1 |
| InChIKey | NGFDFYWXHPHLFF-QPBOURQBSA-N |
| XLogP | 6.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|