C38H69NO2 — CID 66657245
12-(1-cyclohexylprop-1-en-2-yl)-13,19,21,27-tetramethyl-11,28-dioxa-4-azabicyclo[22.3.1]octacos-18-ene (PubChem CID 66657245) has the molecular formula C38H69NO2 and a molecular weight of 571.98 g/mol. Its IUPAC name is 12-(1-cyclohexylprop-1-en-2-yl)-13,19,21,27-tetramethyl-11,28-dioxa-4-azabicyclo[22.3.1]octacos-18-ene.
| Compound Name | 12-(1-cyclohexylprop-1-en-2-yl)-13,19,21,27-tetramethyl-11,28-dioxa-4-azabicyclo[22.3.1]octacos-18-ene |
|---|---|
| PubChem CID | 66657245 |
| Molecular Formula | C38H69NO2 |
| Molecular Weight | 571.98 g/mol |
| Exact Mass | 571.53 |
| IUPAC Name | 12-(1-cyclohexylprop-1-en-2-yl)-13,19,21,27-tetramethyl-11,28-dioxa-4-azabicyclo[22.3.1]octacos-18-ene |
| SMILES | CC1=CCCCCC(C)C(C(C)=CC2CCCCC2)OCCCCCCNCCC2OC(CCC(C)C1)CCC2C |
| InChI | InChI=1S/C38H69NO2/c1-30-16-10-8-11-17-33(4)38(34(5)29-35-18-12-9-13-19-35)40-27-15-7-6-14-25-39-26-24-37-32(3)21-23-36(41-37)22-20-31(2)28-30/h16,29,31-33,35-39H,6-15,17-28H2,1-5H3 |
| InChIKey | TZHUCDKHJPSXTA-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.98 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|