About 8-chloro-1-iminodeca-7,9-dien-3-one
8-chloro-1-iminodeca-7,9-dien-3-one (PubChem CID 123240404) has the molecular formula C10H14ClNO
and a molecular weight of 199.68 g/mol. Its IUPAC name is 8-chloro-1-iminodeca-7,9-dien-3-one.
Molecular Properties
| Compound Name | 8-chloro-1-iminodeca-7,9-dien-3-one |
| PubChem CID | 123240404 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 8-chloro-1-iminodeca-7,9-dien-3-one |
| SMILES | [H]/N=C/CC(=O)CCCC=C(Cl)C=C |
| InChI | InChI=1S/C10H14ClNO/c1-2-9(11)5-3-4-6-10(13)7-8-12/h2,5,8,12H,1,3-4,6-7H2/b9-5?,12-8+ |
| InChIKey | SDUIGKBFZDXCPN-LCYGUJRPSA-N |
| XLogP | 3.07 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-1-iminodeca-7,9-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1-iminodeca-7,9-dien-3-one?
The IUPAC name of 8-chloro-1-iminodeca-7,9-dien-3-one (CID 123240404) is 8-chloro-1-iminodeca-7,9-dien-3-one.
What is the SMILES notation for 8-chloro-1-iminodeca-7,9-dien-3-one?
The canonical SMILES for 8-chloro-1-iminodeca-7,9-dien-3-one is [H]/N=C/CC(=O)CCCC=C(Cl)C=C.
What is the InChIKey of 8-chloro-1-iminodeca-7,9-dien-3-one?
The InChIKey is SDUIGKBFZDXCPN-LCYGUJRPSA-N. The full InChI is InChI=1S/C10H14ClNO/c1-2-9(11)5-3-4-6-10(13)7-8-12/h2,5,8,12H,1,3-4,6-7H2/b9-5?,12-8+.
What are the key properties of 8-chloro-1-iminodeca-7,9-dien-3-one?
8-chloro-1-iminodeca-7,9-dien-3-one has a molecular weight of 199.68 g/mol, XLogP of 3.07, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1-iminodeca-7,9-dien-3-one is sourced from PubChem (CID 123240404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).