C11H14ClNO — CID 123698294
8-chloro-2-methanimidoyldeca-1,7,9-trien-3-one (PubChem CID 123698294) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 8-chloro-2-methanimidoyldeca-1,7,9-trien-3-one.
| Compound Name | 8-chloro-2-methanimidoyldeca-1,7,9-trien-3-one |
|---|---|
| PubChem CID | 123698294 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 8-chloro-2-methanimidoyldeca-1,7,9-trien-3-one |
| SMILES | [H]/N=C/C(=C)C(=O)CCCC=C(Cl)C=C |
| InChI | InChI=1S/C11H14ClNO/c1-3-10(12)6-4-5-7-11(14)9(2)8-13/h3,6,8,13H,1-2,4-5,7H2/b10-6?,13-8+ |
| InChIKey | NPWSMXXCHIKHRU-FUKGFPAKSA-N |
| XLogP | 3.24 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|