C11H12ClNO — CID 123243462
(4Z,6E)-7-chloro-2-methanimidoyl-5-methylnona-1,4,6,8-tetraen-3-one (PubChem CID 123243462) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is (4Z,6E)-7-chloro-2-methanimidoyl-5-methylnona-1,4,6,8-tetraen-3-one.
| Compound Name | (4Z,6E)-7-chloro-2-methanimidoyl-5-methylnona-1,4,6,8-tetraen-3-one |
|---|---|
| PubChem CID | 123243462 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (4Z,6E)-7-chloro-2-methanimidoyl-5-methylnona-1,4,6,8-tetraen-3-one |
| SMILES | [H]/N=C/C(=C)C(=O)/C=C(C)\C=C(\Cl)C=C |
| InChI | InChI=1S/C11H12ClNO/c1-4-10(12)5-8(2)6-11(14)9(3)7-13/h4-7,13H,1,3H2,2H3/b8-6-,10-5+,13-7+ |
| InChIKey | BNSSNUXOEBNACD-FVRHXCRMSA-N |
| XLogP | 3.02 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|