C14H27N — CID 123240819
3,4-dimethyl-2-(3-methylbutan-2-yl)cycloheptan-1-imine (PubChem CID 123240819) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 3,4-dimethyl-2-(3-methylbutan-2-yl)cycloheptan-1-imine.
| Compound Name | 3,4-dimethyl-2-(3-methylbutan-2-yl)cycloheptan-1-imine |
|---|---|
| PubChem CID | 123240819 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 3,4-dimethyl-2-(3-methylbutan-2-yl)cycloheptan-1-imine |
| SMILES | [H]/N=C1\CCCC(C)C(C)C1C(C)C(C)C |
| InChI | InChI=1S/C14H27N/c1-9(2)11(4)14-12(5)10(3)7-6-8-13(14)15/h9-12,14-15H,6-8H2,1-5H3/b15-13+ |
| InChIKey | CTNUFDYPCJETOO-FYWRMAATSA-N |
| XLogP | 4.37 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|