About 5-hexa-2,4-dien-3-ylpyrimidine
5-hexa-2,4-dien-3-ylpyrimidine (PubChem CID 123242398) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-hexa-2,4-dien-3-ylpyrimidine.
Molecular Properties
| Compound Name | 5-hexa-2,4-dien-3-ylpyrimidine |
| PubChem CID | 123242398 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5-hexa-2,4-dien-3-ylpyrimidine |
| SMILES | CC=CC(=CC)c1cncnc1 |
| InChI | InChI=1S/C10H12N2/c1-3-5-9(4-2)10-6-11-8-12-7-10/h3-8H,1-2H3 |
| InChIKey | QBOOUNHLJJFNIU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-hexa-2,4-dien-3-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexa-2,4-dien-3-ylpyrimidine?
The IUPAC name of 5-hexa-2,4-dien-3-ylpyrimidine (CID 123242398) is 5-hexa-2,4-dien-3-ylpyrimidine.
What is the SMILES notation for 5-hexa-2,4-dien-3-ylpyrimidine?
The canonical SMILES for 5-hexa-2,4-dien-3-ylpyrimidine is CC=CC(=CC)c1cncnc1.
What is the InChIKey of 5-hexa-2,4-dien-3-ylpyrimidine?
The InChIKey is QBOOUNHLJJFNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-3-5-9(4-2)10-6-11-8-12-7-10/h3-8H,1-2H3.
What are the key properties of 5-hexa-2,4-dien-3-ylpyrimidine?
5-hexa-2,4-dien-3-ylpyrimidine has a molecular weight of 160.22 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexa-2,4-dien-3-ylpyrimidine is sourced from PubChem (CID 123242398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).