About 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine
4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine (PubChem CID 123243139) has the molecular formula C25H55NO3Si
and a molecular weight of 445.81 g/mol. Its IUPAC name is 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine.
Molecular Properties
| Compound Name | 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine |
| PubChem CID | 123243139 |
| Molecular Formula | C25H55NO3Si |
| Molecular Weight | 445.81 g/mol |
| Exact Mass | 445.40 |
| IUPAC Name | 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine |
| SMILES | CCCCCCO[SiH](OCCCCCC)OCCC(CCC)CCCN(CC)CC |
| InChI | InChI=1S/C25H55NO3Si/c1-6-11-13-15-22-27-30(28-23-16-14-12-7-2)29-24-20-25(18-8-3)19-17-21-26(9-4)10-5/h25,30H,6-24H2,1-5H3 |
| InChIKey | NLKLWKZSJORSKK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.81 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine?
The IUPAC name of 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine (CID 123243139) is 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine.
What is the SMILES notation for 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine?
The canonical SMILES for 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine is CCCCCCO[SiH](OCCCCCC)OCCC(CCC)CCCN(CC)CC.
What is the InChIKey of 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine?
The InChIKey is NLKLWKZSJORSKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H55NO3Si/c1-6-11-13-15-22-27-30(28-23-16-14-12-7-2)29-24-20-25(18-8-3)19-17-21-26(9-4)10-5/h25,30H,6-24H2,1-5H3.
What are the key properties of 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine?
4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine has a molecular weight of 445.81 g/mol, XLogP of 6.84, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-dihexoxysilyloxyethyl)-N,N-diethylheptan-1-amine is sourced from PubChem (CID 123243139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).